C15H19N5O4S — CID 8864456
2-[4-[(Z)-(3-ethyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)iminomethyl]-2,6-dimethoxyphenoxy]acetamide (PubChem CID 8864456) has the molecular formula C15H19N5O4S and a molecular weight of 365.42 g/mol. Its IUPAC name is 2-[4-[(Z)-(3-ethyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)iminomethyl]-2,6-dimethoxyphenoxy]acetamide.
| Compound Name | 2-[4-[(Z)-(3-ethyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)iminomethyl]-2,6-dimethoxyphenoxy]acetamide |
|---|---|
| PubChem CID | 8864456 |
| Molecular Formula | C15H19N5O4S |
| Molecular Weight | 365.42 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | 2-[4-[(Z)-(3-ethyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)iminomethyl]-2,6-dimethoxyphenoxy]acetamide |
| SMILES | CCc1n[nH]c(=S)n1/N=C\c1cc(OC)c(OCC(N)=O)c(OC)c1 |
| InChI | InChI=1S/C15H19N5O4S/c1-4-13-18-19-15(25)20(13)17-7-9-5-10(22-2)14(11(6-9)23-3)24-8-12(16)21/h5-7H,4,8H2,1-3H3,(H2,16,21)(H,19,25)/b17-7- |
| InChIKey | ZZARKXOENAEXEW-IDUWFGFVSA-N |
| XLogP | 1.27 |
| TPSA | 116.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.42 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|