C14H24O4S — CID 88644812
5-ethoxy-4,6,6-trimethyl-1-propylcyclohexa-2,4-diene-1-sulfonic acid (PubChem CID 88644812) has the molecular formula C14H24O4S and a molecular weight of 288.41 g/mol. Its IUPAC name is 5-ethoxy-4,6,6-trimethyl-1-propylcyclohexa-2,4-diene-1-sulfonic acid.
| Compound Name | 5-ethoxy-4,6,6-trimethyl-1-propylcyclohexa-2,4-diene-1-sulfonic acid |
|---|---|
| PubChem CID | 88644812 |
| Molecular Formula | C14H24O4S |
| Molecular Weight | 288.41 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 5-ethoxy-4,6,6-trimethyl-1-propylcyclohexa-2,4-diene-1-sulfonic acid |
| SMILES | CCCC1(S(=O)(=O)O)C=CC(C)=C(OCC)C1(C)C |
| InChI | InChI=1S/C14H24O4S/c1-6-9-14(19(15,16)17)10-8-11(3)12(18-7-2)13(14,4)5/h8,10H,6-7,9H2,1-5H3,(H,15,16,17) |
| InChIKey | DGOCKFHWADHYTK-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.41 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|