C12H19FO3S — CID 88644913
5-fluoro-4,6,6-trimethyl-1-propylcyclohexa-2,4-diene-1-sulfonic acid (PubChem CID 88644913) has the molecular formula C12H19FO3S and a molecular weight of 262.35 g/mol. Its IUPAC name is 5-fluoro-4,6,6-trimethyl-1-propylcyclohexa-2,4-diene-1-sulfonic acid.
| Compound Name | 5-fluoro-4,6,6-trimethyl-1-propylcyclohexa-2,4-diene-1-sulfonic acid |
|---|---|
| PubChem CID | 88644913 |
| Molecular Formula | C12H19FO3S |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | 5-fluoro-4,6,6-trimethyl-1-propylcyclohexa-2,4-diene-1-sulfonic acid |
| SMILES | CCCC1(S(=O)(=O)O)C=CC(C)=C(F)C1(C)C |
| InChI | InChI=1S/C12H19FO3S/c1-5-7-12(17(14,15)16)8-6-9(2)10(13)11(12,3)4/h6,8H,5,7H2,1-4H3,(H,14,15,16) |
| InChIKey | YAQWTNPQKXIZNC-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|