About 5,5-dichlorocyclohexa-1,3-dien-1-amine
5,5-dichlorocyclohexa-1,3-dien-1-amine (PubChem CID 88645340) has the molecular formula C6H7Cl2N
and a molecular weight of 164.04 g/mol. Its IUPAC name is 5,5-dichlorocyclohexa-1,3-dien-1-amine.
Molecular Properties
| Compound Name | 5,5-dichlorocyclohexa-1,3-dien-1-amine |
| PubChem CID | 88645340 |
| Molecular Formula | C6H7Cl2N |
| Molecular Weight | 164.04 g/mol |
| Exact Mass | 163.00 |
| IUPAC Name | 5,5-dichlorocyclohexa-1,3-dien-1-amine |
| SMILES | NC1=CC=CC(Cl)(Cl)C1 |
| InChI | InChI=1S/C6H7Cl2N/c7-6(8)3-1-2-5(9)4-6/h1-3H,4,9H2 |
| InChIKey | XPDBQQOXEHPGQT-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.04 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5,5-dichlorocyclohexa-1,3-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-dichlorocyclohexa-1,3-dien-1-amine?
The IUPAC name of 5,5-dichlorocyclohexa-1,3-dien-1-amine (CID 88645340) is 5,5-dichlorocyclohexa-1,3-dien-1-amine.
What is the SMILES notation for 5,5-dichlorocyclohexa-1,3-dien-1-amine?
The canonical SMILES for 5,5-dichlorocyclohexa-1,3-dien-1-amine is NC1=CC=CC(Cl)(Cl)C1.
What is the InChIKey of 5,5-dichlorocyclohexa-1,3-dien-1-amine?
The InChIKey is XPDBQQOXEHPGQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7Cl2N/c7-6(8)3-1-2-5(9)4-6/h1-3H,4,9H2.
What are the key properties of 5,5-dichlorocyclohexa-1,3-dien-1-amine?
5,5-dichlorocyclohexa-1,3-dien-1-amine has a molecular weight of 164.04 g/mol, XLogP of 1.96, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-dichlorocyclohexa-1,3-dien-1-amine is sourced from PubChem (CID 88645340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).