About 2-cyclononyl-2,3-diisocyanatothionane
2-cyclononyl-2,3-diisocyanatothionane (PubChem CID 88646147) has the molecular formula C19H30N2O2S
and a molecular weight of 350.53 g/mol. Its IUPAC name is 2-cyclononyl-2,3-diisocyanatothionane.
Molecular Properties
| Compound Name | 2-cyclononyl-2,3-diisocyanatothionane |
| PubChem CID | 88646147 |
| Molecular Formula | C19H30N2O2S |
| Molecular Weight | 350.53 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | 2-cyclononyl-2,3-diisocyanatothionane |
| SMILES | O=C=NC1CCCCCCSC1(N=C=O)C1CCCCCCCC1 |
| InChI | InChI=1S/C19H30N2O2S/c22-15-20-18-13-9-5-6-10-14-24-19(18,21-16-23)17-11-7-3-1-2-4-8-12-17/h17-18H,1-14H2 |
| InChIKey | BGPDAEZSCFYFSB-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 350.53 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclononyl-2,3-diisocyanatothionane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclononyl-2,3-diisocyanatothionane?
The IUPAC name of 2-cyclononyl-2,3-diisocyanatothionane (CID 88646147) is 2-cyclononyl-2,3-diisocyanatothionane.
What is the SMILES notation for 2-cyclononyl-2,3-diisocyanatothionane?
The canonical SMILES for 2-cyclononyl-2,3-diisocyanatothionane is O=C=NC1CCCCCCSC1(N=C=O)C1CCCCCCCC1.
What is the InChIKey of 2-cyclononyl-2,3-diisocyanatothionane?
The InChIKey is BGPDAEZSCFYFSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H30N2O2S/c22-15-20-18-13-9-5-6-10-14-24-19(18,21-16-23)17-11-7-3-1-2-4-8-12-17/h17-18H,1-14H2.
What are the key properties of 2-cyclononyl-2,3-diisocyanatothionane?
2-cyclononyl-2,3-diisocyanatothionane has a molecular weight of 350.53 g/mol, XLogP of 5.17, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclononyl-2,3-diisocyanatothionane is sourced from PubChem (CID 88646147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).