About prop-2-enyl N'-(2-hydrazinylideneethyl)carbamimidothioate;hydrochloride
prop-2-enyl N'-(2-hydrazinylideneethyl)carbamimidothioate;hydrochloride (PubChem CID 88646221) has the molecular formula C6H13ClN4S
and a molecular weight of 208.72 g/mol. Its IUPAC name is prop-2-enyl N'-(2-hydrazinylideneethyl)carbamimidothioate;hydrochloride.
Molecular Properties
| Compound Name | prop-2-enyl N'-(2-hydrazinylideneethyl)carbamimidothioate;hydrochloride |
| PubChem CID | 88646221 |
| Molecular Formula | C6H13ClN4S |
| Molecular Weight | 208.72 g/mol |
| Exact Mass | 208.05 |
| IUPAC Name | prop-2-enyl N'-(2-hydrazinylideneethyl)carbamimidothioate;hydrochloride |
| SMILES | C=CCS/C(N)=N\CC=NN.Cl |
| InChI | InChI=1S/C6H12N4S.ClH/c1-2-5-11-6(7)9-3-4-10-8;/h2,4H,1,3,5,8H2,(H2,7,9);1H |
| InChIKey | IEJHFXJZZXFMOU-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 76.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.72 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze prop-2-enyl N'-(2-hydrazinylideneethyl)carbamimidothioate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-enyl N'-(2-hydrazinylideneethyl)carbamimidothioate;hydrochloride?
The IUPAC name of prop-2-enyl N'-(2-hydrazinylideneethyl)carbamimidothioate;hydrochloride (CID 88646221) is prop-2-enyl N'-(2-hydrazinylideneethyl)carbamimidothioate;hydrochloride.
What is the SMILES notation for prop-2-enyl N'-(2-hydrazinylideneethyl)carbamimidothioate;hydrochloride?
The canonical SMILES for prop-2-enyl N'-(2-hydrazinylideneethyl)carbamimidothioate;hydrochloride is C=CCS/C(N)=N\CC=NN.Cl.
What is the InChIKey of prop-2-enyl N'-(2-hydrazinylideneethyl)carbamimidothioate;hydrochloride?
The InChIKey is IEJHFXJZZXFMOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N4S.ClH/c1-2-5-11-6(7)9-3-4-10-8;/h2,4H,1,3,5,8H2,(H2,7,9);1H.
What are the key properties of prop-2-enyl N'-(2-hydrazinylideneethyl)carbamimidothioate;hydrochloride?
prop-2-enyl N'-(2-hydrazinylideneethyl)carbamimidothioate;hydrochloride has a molecular weight of 208.72 g/mol, XLogP of 0.59, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-enyl N'-(2-hydrazinylideneethyl)carbamimidothioate;hydrochloride is sourced from PubChem (CID 88646221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).