C30H34BrN3O6S — CID 88646565
diethyl 3-[[4-(5-bromo-2,4-dimethoxyphenyl)-1,3-thiazol-2-yl]amino]-2,6-dimethyl-4-phenyl-2,4-dihydro-1H-pyridine-3,5-dicarboxylate (PubChem CID 88646565) has the molecular formula C30H34BrN3O6S and a molecular weight of 644.59 g/mol. Its IUPAC name is diethyl 3-[[4-(5-bromo-2,4-dimethoxyphenyl)-1,3-thiazol-2-yl]amino]-2,6-dimethyl-4-phenyl-2,4-dihydro-1H-pyridine-3,5-dicarboxylate.
| Compound Name | diethyl 3-[[4-(5-bromo-2,4-dimethoxyphenyl)-1,3-thiazol-2-yl]amino]-2,6-dimethyl-4-phenyl-2,4-dihydro-1H-pyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 88646565 |
| Molecular Formula | C30H34BrN3O6S |
| Molecular Weight | 644.59 g/mol |
| Exact Mass | 643.14 |
| IUPAC Name | diethyl 3-[[4-(5-bromo-2,4-dimethoxyphenyl)-1,3-thiazol-2-yl]amino]-2,6-dimethyl-4-phenyl-2,4-dihydro-1H-pyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C)NC(C)C(Nc2nc(-c3cc(Br)c(OC)cc3OC)cs2)(C(=O)OCC)C1c1ccccc1 |
| InChI | InChI=1S/C30H34BrN3O6S/c1-7-39-27(35)25-17(3)32-18(4)30(28(36)40-8-2,26(25)19-12-10-9-11-13-19)34-29-33-22(16-41-29)20-14-21(31)24(38-6)15-23(20)37-5/h9-16,18,26,32H,7-8H2,1-6H3,(H,33,34) |
| InChIKey | IRCFKLPZRBPUPJ-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 108.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.59 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |