About (2-bromoacetyl) (2S)-2-(2-fluorophenoxy)pyrrolidine-2-carboxylate
(2-bromoacetyl) (2S)-2-(2-fluorophenoxy)pyrrolidine-2-carboxylate (PubChem CID 88646840) has the molecular formula C13H13BrFNO4
and a molecular weight of 346.15 g/mol. Its IUPAC name is (2-bromoacetyl) (2S)-2-(2-fluorophenoxy)pyrrolidine-2-carboxylate.
Molecular Properties
| Compound Name | (2-bromoacetyl) (2S)-2-(2-fluorophenoxy)pyrrolidine-2-carboxylate |
| PubChem CID | 88646840 |
| Molecular Formula | C13H13BrFNO4 |
| Molecular Weight | 346.15 g/mol |
| Exact Mass | 345.00 |
| IUPAC Name | (2-bromoacetyl) (2S)-2-(2-fluorophenoxy)pyrrolidine-2-carboxylate |
| SMILES | O=C(CBr)OC(=O)[C@@]1(Oc2ccccc2F)CCCN1 |
| InChI | InChI=1S/C13H13BrFNO4/c14-8-11(17)19-12(18)13(6-3-7-16-13)20-10-5-2-1-4-9(10)15/h1-2,4-5,16H,3,6-8H2/t13-/m0/s1 |
| InChIKey | ULIFSXKPOXOZBR-ZDUSSCGKSA-N |
| XLogP | 1.75 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.15 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze (2-bromoacetyl) (2S)-2-(2-fluorophenoxy)pyrrolidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-bromoacetyl) (2S)-2-(2-fluorophenoxy)pyrrolidine-2-carboxylate?
The IUPAC name of (2-bromoacetyl) (2S)-2-(2-fluorophenoxy)pyrrolidine-2-carboxylate (CID 88646840) is (2-bromoacetyl) (2S)-2-(2-fluorophenoxy)pyrrolidine-2-carboxylate.
What is the SMILES notation for (2-bromoacetyl) (2S)-2-(2-fluorophenoxy)pyrrolidine-2-carboxylate?
The canonical SMILES for (2-bromoacetyl) (2S)-2-(2-fluorophenoxy)pyrrolidine-2-carboxylate is O=C(CBr)OC(=O)[C@@]1(Oc2ccccc2F)CCCN1.
What is the InChIKey of (2-bromoacetyl) (2S)-2-(2-fluorophenoxy)pyrrolidine-2-carboxylate?
The InChIKey is ULIFSXKPOXOZBR-ZDUSSCGKSA-N. The full InChI is InChI=1S/C13H13BrFNO4/c14-8-11(17)19-12(18)13(6-3-7-16-13)20-10-5-2-1-4-9(10)15/h1-2,4-5,16H,3,6-8H2/t13-/m0/s1.
What are the key properties of (2-bromoacetyl) (2S)-2-(2-fluorophenoxy)pyrrolidine-2-carboxylate?
(2-bromoacetyl) (2S)-2-(2-fluorophenoxy)pyrrolidine-2-carboxylate has a molecular weight of 346.15 g/mol, XLogP of 1.75, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-bromoacetyl) (2S)-2-(2-fluorophenoxy)pyrrolidine-2-carboxylate is sourced from PubChem (CID 88646840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).