C19H31F2NO4 — CID 88647104
tert-butyl N-(4,4-difluoronona-1,8-dien-3-yl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate (PubChem CID 88647104) has the molecular formula C19H31F2NO4 and a molecular weight of 375.46 g/mol. Its IUPAC name is tert-butyl N-(4,4-difluoronona-1,8-dien-3-yl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate.
| Compound Name | tert-butyl N-(4,4-difluoronona-1,8-dien-3-yl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate |
|---|---|
| PubChem CID | 88647104 |
| Molecular Formula | C19H31F2NO4 |
| Molecular Weight | 375.46 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | tert-butyl N-(4,4-difluoronona-1,8-dien-3-yl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate |
| SMILES | C=CCCCC(F)(F)C(C=C)N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H31F2NO4/c1-9-11-12-13-19(20,21)14(10-2)22(15(23)25-17(3,4)5)16(24)26-18(6,7)8/h9-10,14H,1-2,11-13H2,3-8H3 |
| InChIKey | YDDRKDSKIUAJOG-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.46 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|