About (3-methyl-1,2-oxazol-5-yl)methyl N,N-bis(1-sulfanylpropan-2-yl)carbamate
(3-methyl-1,2-oxazol-5-yl)methyl N,N-bis(1-sulfanylpropan-2-yl)carbamate (PubChem CID 88648371) has the molecular formula C12H20N2O3S2
and a molecular weight of 304.44 g/mol. Its IUPAC name is (3-methyl-1,2-oxazol-5-yl)methyl N,N-bis(1-sulfanylpropan-2-yl)carbamate.
Molecular Properties
| Compound Name | (3-methyl-1,2-oxazol-5-yl)methyl N,N-bis(1-sulfanylpropan-2-yl)carbamate |
| PubChem CID | 88648371 |
| Molecular Formula | C12H20N2O3S2 |
| Molecular Weight | 304.44 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | (3-methyl-1,2-oxazol-5-yl)methyl N,N-bis(1-sulfanylpropan-2-yl)carbamate |
| SMILES | Cc1cc(COC(=O)N(C(C)CS)C(C)CS)on1 |
| InChI | InChI=1S/C12H20N2O3S2/c1-8-4-11(17-13-8)5-16-12(15)14(9(2)6-18)10(3)7-19/h4,9-10,18-19H,5-7H2,1-3H3 |
| InChIKey | NYVRPYIOFVPLOO-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 55.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.44 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (3-methyl-1,2-oxazol-5-yl)methyl N,N-bis(1-sulfanylpropan-2-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methyl-1,2-oxazol-5-yl)methyl N,N-bis(1-sulfanylpropan-2-yl)carbamate?
The IUPAC name of (3-methyl-1,2-oxazol-5-yl)methyl N,N-bis(1-sulfanylpropan-2-yl)carbamate (CID 88648371) is (3-methyl-1,2-oxazol-5-yl)methyl N,N-bis(1-sulfanylpropan-2-yl)carbamate.
What is the SMILES notation for (3-methyl-1,2-oxazol-5-yl)methyl N,N-bis(1-sulfanylpropan-2-yl)carbamate?
The canonical SMILES for (3-methyl-1,2-oxazol-5-yl)methyl N,N-bis(1-sulfanylpropan-2-yl)carbamate is Cc1cc(COC(=O)N(C(C)CS)C(C)CS)on1.
What is the InChIKey of (3-methyl-1,2-oxazol-5-yl)methyl N,N-bis(1-sulfanylpropan-2-yl)carbamate?
The InChIKey is NYVRPYIOFVPLOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N2O3S2/c1-8-4-11(17-13-8)5-16-12(15)14(9(2)6-18)10(3)7-19/h4,9-10,18-19H,5-7H2,1-3H3.
What are the key properties of (3-methyl-1,2-oxazol-5-yl)methyl N,N-bis(1-sulfanylpropan-2-yl)carbamate?
(3-methyl-1,2-oxazol-5-yl)methyl N,N-bis(1-sulfanylpropan-2-yl)carbamate has a molecular weight of 304.44 g/mol, XLogP of 2.56, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methyl-1,2-oxazol-5-yl)methyl N,N-bis(1-sulfanylpropan-2-yl)carbamate is sourced from PubChem (CID 88648371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).