C36H47N3O8S — CID 88648600
benzoyl 4-[(5R)-6-ethoxy-5-[[5-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-4-oxo-2,3-dihydro-1,5-benzothiazepin-3-yl]amino]-6-oxohexyl]piperidine-1-carboxylate (PubChem CID 88648600) has the molecular formula C36H47N3O8S and a molecular weight of 681.85 g/mol. Its IUPAC name is benzoyl 4-[(5R)-6-ethoxy-5-[[5-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-4-oxo-2,3-dihydro-1,5-benzothiazepin-3-yl]amino]-6-oxohexyl]piperidine-1-carboxylate.
| Compound Name | benzoyl 4-[(5R)-6-ethoxy-5-[[5-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-4-oxo-2,3-dihydro-1,5-benzothiazepin-3-yl]amino]-6-oxohexyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 88648600 |
| Molecular Formula | C36H47N3O8S |
| Molecular Weight | 681.85 g/mol |
| Exact Mass | 681.31 |
| IUPAC Name | benzoyl 4-[(5R)-6-ethoxy-5-[[5-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-4-oxo-2,3-dihydro-1,5-benzothiazepin-3-yl]amino]-6-oxohexyl]piperidine-1-carboxylate |
| SMILES | CCOC(=O)[C@@H](CCCCC1CCN(C(=O)OC(=O)c2ccccc2)CC1)NC1CSc2ccccc2N(CC(=O)OC(C)(C)C)C1=O |
| InChI | InChI=1S/C36H47N3O8S/c1-5-45-34(43)27(16-10-9-13-25-19-21-38(22-20-25)35(44)46-33(42)26-14-7-6-8-15-26)37-28-24-48-30-18-12-11-17-29(30)39(32(28)41)23-31(40)47-36(2,3)4/h6-8,11-12,14-15,17-18,25,27-28,37H,5,9-10,13,16,19-24H2,1-4H3/t27-,28?/m1/s1 |
| InChIKey | SLNBRMCLRBAUPT-QXPUDEPPSA-N |
| XLogP | 5.61 |
| TPSA | 131.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.85 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|