C17H15Cl2N5O5 — CID 88648941
N-[4-[(3,5-dichloro-2H-pyrimidin-4-yl)oxy]phenyl]-1,3-dimethyl-2,4,6-trioxo-1,3-diazinane-5-carboxamide (PubChem CID 88648941) has the molecular formula C17H15Cl2N5O5 and a molecular weight of 440.24 g/mol. Its IUPAC name is N-[4-[(3,5-dichloro-2H-pyrimidin-4-yl)oxy]phenyl]-1,3-dimethyl-2,4,6-trioxo-1,3-diazinane-5-carboxamide.
| Compound Name | N-[4-[(3,5-dichloro-2H-pyrimidin-4-yl)oxy]phenyl]-1,3-dimethyl-2,4,6-trioxo-1,3-diazinane-5-carboxamide |
|---|---|
| PubChem CID | 88648941 |
| Molecular Formula | C17H15Cl2N5O5 |
| Molecular Weight | 440.24 g/mol |
| Exact Mass | 439.05 |
| IUPAC Name | N-[4-[(3,5-dichloro-2H-pyrimidin-4-yl)oxy]phenyl]-1,3-dimethyl-2,4,6-trioxo-1,3-diazinane-5-carboxamide |
| SMILES | CN1C(=O)C(C(=O)Nc2ccc(OC3=C(Cl)C=NCN3Cl)cc2)C(=O)N(C)C1=O |
| InChI | InChI=1S/C17H15Cl2N5O5/c1-22-14(26)12(15(27)23(2)17(22)28)13(25)21-9-3-5-10(6-4-9)29-16-11(18)7-20-8-24(16)19/h3-7,12H,8H2,1-2H3,(H,21,25) |
| InChIKey | ONDHKCAOMZITEN-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 111.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.24 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|