C17H22F3N9O5 — CID 88649473
(Z)-but-2-enedioic acid;1-cyano-2-methyl-3-[3-[4-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrimidin-2-yl]oxypropyl]guanidine (PubChem CID 88649473) has the molecular formula C17H22F3N9O5 and a molecular weight of 489.42 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;1-cyano-2-methyl-3-[3-[4-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrimidin-2-yl]oxypropyl]guanidine.
| Compound Name | (Z)-but-2-enedioic acid;1-cyano-2-methyl-3-[3-[4-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrimidin-2-yl]oxypropyl]guanidine |
|---|---|
| PubChem CID | 88649473 |
| Molecular Formula | C17H22F3N9O5 |
| Molecular Weight | 489.42 g/mol |
| Exact Mass | 489.17 |
| IUPAC Name | (Z)-but-2-enedioic acid;1-cyano-2-methyl-3-[3-[4-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]pyrimidin-2-yl]oxypropyl]guanidine |
| SMILES | C/N=C(\NC#N)NCCCOc1nccc(N/C(N)=N/CC(F)(F)F)n1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C13H18F3N9O.C4H4O4/c1-19-11(23-8-17)20-4-2-6-26-12-21-5-3-9(25-12)24-10(18)22-7-13(14,15)16;5-3(6)1-2-4(7)8/h3,5H,2,4,6-7H2,1H3,(H2,19,20,23)(H3,18,21,22,24,25);1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | UDPMRNFKTVUXAP-BTJKTKAUSA-N |
| XLogP | -0.11 |
| TPSA | 220.23 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.42 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|