C21H32ClNO6S3Si — CID 88650367
2-chloroprop-2-enyl 2-[(3S,4R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxo-4-(1-oxothiolane-3-carbothioyl)sulfanylazetidin-1-yl]-2-oxoacetate (PubChem CID 88650367) has the molecular formula C21H32ClNO6S3Si and a molecular weight of 554.23 g/mol. Its IUPAC name is 2-chloroprop-2-enyl 2-[(3S,4R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxo-4-(1-oxothiolane-3-carbothioyl)sulfanylazetidin-1-yl]-2-oxoacetate.
| Compound Name | 2-chloroprop-2-enyl 2-[(3S,4R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxo-4-(1-oxothiolane-3-carbothioyl)sulfanylazetidin-1-yl]-2-oxoacetate |
|---|---|
| PubChem CID | 88650367 |
| Molecular Formula | C21H32ClNO6S3Si |
| Molecular Weight | 554.23 g/mol |
| Exact Mass | 553.08 |
| IUPAC Name | 2-chloroprop-2-enyl 2-[(3S,4R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxo-4-(1-oxothiolane-3-carbothioyl)sulfanylazetidin-1-yl]-2-oxoacetate |
| SMILES | C=C(Cl)COC(=O)C(=O)N1C(=O)[C@H]([C@@H](C)O[Si](C)(C)C(C)(C)C)[C@H]1SC(=S)C1CCS(=O)C1 |
| InChI | InChI=1S/C21H32ClNO6S3Si/c1-12(22)10-28-19(26)17(25)23-16(24)15(13(2)29-33(6,7)21(3,4)5)18(23)31-20(30)14-8-9-32(27)11-14/h13-15,18H,1,8-11H2,2-7H3/t13-,14?,15+,18-,32?/m1/s1 |
| InChIKey | ZBPPEJAJLKLUII-WUSOXVBGSA-N |
| XLogP | 3.83 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.23 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|