About 1,2-diethoxy-N,N-dimethylethanamine
1,2-diethoxy-N,N-dimethylethanamine (PubChem CID 88650398) has the molecular formula C8H19NO2
and a molecular weight of 161.25 g/mol. Its IUPAC name is 1,2-diethoxy-N,N-dimethylethanamine.
Molecular Properties
| Compound Name | 1,2-diethoxy-N,N-dimethylethanamine |
| PubChem CID | 88650398 |
| Molecular Formula | C8H19NO2 |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.14 |
| IUPAC Name | 1,2-diethoxy-N,N-dimethylethanamine |
| SMILES | CCOCC(OCC)N(C)C |
| InChI | InChI=1S/C8H19NO2/c1-5-10-7-8(9(3)4)11-6-2/h8H,5-7H2,1-4H3 |
| InChIKey | HTPJBLXQGLXHPK-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1,2-diethoxy-N,N-dimethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-diethoxy-N,N-dimethylethanamine?
The IUPAC name of 1,2-diethoxy-N,N-dimethylethanamine (CID 88650398) is 1,2-diethoxy-N,N-dimethylethanamine.
What is the SMILES notation for 1,2-diethoxy-N,N-dimethylethanamine?
The canonical SMILES for 1,2-diethoxy-N,N-dimethylethanamine is CCOCC(OCC)N(C)C.
What is the InChIKey of 1,2-diethoxy-N,N-dimethylethanamine?
The InChIKey is HTPJBLXQGLXHPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19NO2/c1-5-10-7-8(9(3)4)11-6-2/h8H,5-7H2,1-4H3.
What are the key properties of 1,2-diethoxy-N,N-dimethylethanamine?
1,2-diethoxy-N,N-dimethylethanamine has a molecular weight of 161.25 g/mol, XLogP of 0.95, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-diethoxy-N,N-dimethylethanamine is sourced from PubChem (CID 88650398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).