About methyl N-[carbonofluoridoyl-(2,2-dimethyl-3H-1-benzofuran-7-yl)amino]carbamate
methyl N-[carbonofluoridoyl-(2,2-dimethyl-3H-1-benzofuran-7-yl)amino]carbamate (PubChem CID 88650431) has the molecular formula C13H15FN2O4
and a molecular weight of 282.27 g/mol. Its IUPAC name is methyl N-[carbonofluoridoyl-(2,2-dimethyl-3H-1-benzofuran-7-yl)amino]carbamate.
Molecular Properties
| Compound Name | methyl N-[carbonofluoridoyl-(2,2-dimethyl-3H-1-benzofuran-7-yl)amino]carbamate |
| PubChem CID | 88650431 |
| Molecular Formula | C13H15FN2O4 |
| Molecular Weight | 282.27 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | methyl N-[carbonofluoridoyl-(2,2-dimethyl-3H-1-benzofuran-7-yl)amino]carbamate |
| SMILES | COC(=O)NN(C(=O)F)c1cccc2c1OC(C)(C)C2 |
| InChI | InChI=1S/C13H15FN2O4/c1-13(2)7-8-5-4-6-9(10(8)20-13)16(11(14)17)15-12(18)19-3/h4-6H,7H2,1-3H3,(H,15,18) |
| InChIKey | VXYJGQRWLIORCA-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.27 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl N-[carbonofluoridoyl-(2,2-dimethyl-3H-1-benzofuran-7-yl)amino]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-[carbonofluoridoyl-(2,2-dimethyl-3H-1-benzofuran-7-yl)amino]carbamate?
The IUPAC name of methyl N-[carbonofluoridoyl-(2,2-dimethyl-3H-1-benzofuran-7-yl)amino]carbamate (CID 88650431) is methyl N-[carbonofluoridoyl-(2,2-dimethyl-3H-1-benzofuran-7-yl)amino]carbamate.
What is the SMILES notation for methyl N-[carbonofluoridoyl-(2,2-dimethyl-3H-1-benzofuran-7-yl)amino]carbamate?
The canonical SMILES for methyl N-[carbonofluoridoyl-(2,2-dimethyl-3H-1-benzofuran-7-yl)amino]carbamate is COC(=O)NN(C(=O)F)c1cccc2c1OC(C)(C)C2.
What is the InChIKey of methyl N-[carbonofluoridoyl-(2,2-dimethyl-3H-1-benzofuran-7-yl)amino]carbamate?
The InChIKey is VXYJGQRWLIORCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15FN2O4/c1-13(2)7-8-5-4-6-9(10(8)20-13)16(11(14)17)15-12(18)19-3/h4-6H,7H2,1-3H3,(H,15,18).
What are the key properties of methyl N-[carbonofluoridoyl-(2,2-dimethyl-3H-1-benzofuran-7-yl)amino]carbamate?
methyl N-[carbonofluoridoyl-(2,2-dimethyl-3H-1-benzofuran-7-yl)amino]carbamate has a molecular weight of 282.27 g/mol, XLogP of 2.57, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-[carbonofluoridoyl-(2,2-dimethyl-3H-1-benzofuran-7-yl)amino]carbamate is sourced from PubChem (CID 88650431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).