C14H30O5 — CID 88650438
2,2-bis(hydroxymethyl)-8,8-dimethyldecane-1,9,9-triol (PubChem CID 88650438) has the molecular formula C14H30O5 and a molecular weight of 278.39 g/mol. Its IUPAC name is 2,2-bis(hydroxymethyl)-8,8-dimethyldecane-1,9,9-triol.
| Compound Name | 2,2-bis(hydroxymethyl)-8,8-dimethyldecane-1,9,9-triol |
|---|---|
| PubChem CID | 88650438 |
| Molecular Formula | C14H30O5 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.21 |
| IUPAC Name | 2,2-bis(hydroxymethyl)-8,8-dimethyldecane-1,9,9-triol |
| SMILES | CC(O)(O)C(C)(C)CCCCCC(CO)(CO)CO |
| InChI | InChI=1S/C14H30O5/c1-12(2,13(3,18)19)7-5-4-6-8-14(9-15,10-16)11-17/h15-19H,4-11H2,1-3H3 |
| InChIKey | BIOVHAQMCFBDDU-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|