C79H138N8O15 — CID 88650685
(1-butanoyl-2,2,6,6-tetramethylpiperidin-4-yl) 2-[bis[2-[bis[2-(1-butanoyl-2,2,6,6-tetramethylpiperidin-4-yl)oxy-2-oxoethyl]amino]ethyl]amino]acetate (PubChem CID 88650685) has the molecular formula C79H138N8O15 and a molecular weight of 1440.01 g/mol. Its IUPAC name is (1-butanoyl-2,2,6,6-tetramethylpiperidin-4-yl) 2-[bis[2-[bis[2-(1-butanoyl-2,2,6,6-tetramethylpiperidin-4-yl)oxy-2-oxoethyl]amino]ethyl]amino]acetate.
| Compound Name | (1-butanoyl-2,2,6,6-tetramethylpiperidin-4-yl) 2-[bis[2-[bis[2-(1-butanoyl-2,2,6,6-tetramethylpiperidin-4-yl)oxy-2-oxoethyl]amino]ethyl]amino]acetate |
|---|---|
| PubChem CID | 88650685 |
| Molecular Formula | C79H138N8O15 |
| Molecular Weight | 1440.01 g/mol |
| Exact Mass | 1439.03 |
| IUPAC Name | (1-butanoyl-2,2,6,6-tetramethylpiperidin-4-yl) 2-[bis[2-[bis[2-(1-butanoyl-2,2,6,6-tetramethylpiperidin-4-yl)oxy-2-oxoethyl]amino]ethyl]amino]acetate |
| SMILES | CCCC(=O)N1C(C)(C)CC(OC(=O)CN(CCN(CC(=O)OC2CC(C)(C)N(C(=O)CCC)C(C)(C)C2)CC(=O)OC2CC(C)(C)N(C(=O)CCC)C(C)(C)C2)CCN(CC(=O)OC2CC(C)(C)N(C(=O)CCC)C(C)(C)C2)CC(=O)OC2CC(C)(C)N(C(=O)CCC)C(C)(C)C2)CC1(C)C |
| InChI | InChI=1S/C79H138N8O15/c1-26-31-60(88)83-70(6,7)40-55(41-71(83,8)9)98-65(93)50-80(36-38-81(51-66(94)99-56-42-72(10,11)84(61(89)32-27-2)73(12,13)43-56)52-67(95)100-57-44-74(14,15)85(62(90)33-28-3)75(16,17)45-57)37-39-82(53-68(96)101-58-46-76(18,19)86(63(91)34-29-4)77(20,21)47-58)54-69(97)102-59-48-78(22,23)87(64(92)35-30-5)79(24,25)49-59/h55-59H,26-54H2,1-25H3 |
| InChIKey | CNYBNJCZTDXTEM-UHFFFAOYSA-N |
| XLogP | 11.35 |
| TPSA | 242.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 102 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1440.01 |
| LogP ≤ 5 | 11.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|