C23H23FN2O3S2 — CID 88650848
[(6aR,10aR)-5-(4-fluorophenyl)sulfanyl-7,9-dimethyl-6,6a,8,10a-tetrahydroindolo[4,3-fg]quinolin-4-yl] methanesulfonate (PubChem CID 88650848) has the molecular formula C23H23FN2O3S2 and a molecular weight of 458.58 g/mol. Its IUPAC name is [(6aR,10aR)-5-(4-fluorophenyl)sulfanyl-7,9-dimethyl-6,6a,8,10a-tetrahydroindolo[4,3-fg]quinolin-4-yl] methanesulfonate.
| Compound Name | [(6aR,10aR)-5-(4-fluorophenyl)sulfanyl-7,9-dimethyl-6,6a,8,10a-tetrahydroindolo[4,3-fg]quinolin-4-yl] methanesulfonate |
|---|---|
| PubChem CID | 88650848 |
| Molecular Formula | C23H23FN2O3S2 |
| Molecular Weight | 458.58 g/mol |
| Exact Mass | 458.11 |
| IUPAC Name | [(6aR,10aR)-5-(4-fluorophenyl)sulfanyl-7,9-dimethyl-6,6a,8,10a-tetrahydroindolo[4,3-fg]quinolin-4-yl] methanesulfonate |
| SMILES | CC1=C[C@@H]2c3cccc4c3c(c(Sc3ccc(F)cc3)n4OS(C)(=O)=O)C[C@H]2N(C)C1 |
| InChI | InChI=1S/C23H23FN2O3S2/c1-14-11-18-17-5-4-6-20-22(17)19(12-21(18)25(2)13-14)23(26(20)29-31(3,27)28)30-16-9-7-15(24)8-10-16/h4-11,18,21H,12-13H2,1-3H3/t18-,21-/m1/s1 |
| InChIKey | MONDIQRXWMPELW-WIYYLYMNSA-N |
| XLogP | 4.22 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.58 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|