About (dicyclohexyl-λ4-sulfanylidene)-hydroxy-sulfanylphosphanium
(dicyclohexyl-λ4-sulfanylidene)-hydroxy-sulfanylphosphanium (PubChem CID 88651106) has the molecular formula C12H24OPS2+
and a molecular weight of 279.43 g/mol. Its IUPAC name is (dicyclohexyl-λ4-sulfanylidene)-hydroxy-sulfanylphosphanium.
Molecular Properties
| Compound Name | (dicyclohexyl-λ4-sulfanylidene)-hydroxy-sulfanylphosphanium |
| PubChem CID | 88651106 |
| Molecular Formula | C12H24OPS2+ |
| Molecular Weight | 279.43 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | (dicyclohexyl-λ4-sulfanylidene)-hydroxy-sulfanylphosphanium |
| SMILES | O[P+](S)=S(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C12H24OPS2/c13-14(15)16(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h11-13,15H,1-10H2/q+1 |
| InChIKey | XIECQHXLDFQCEM-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.43 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (dicyclohexyl-λ4-sulfanylidene)-hydroxy-sulfanylphosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (dicyclohexyl-λ4-sulfanylidene)-hydroxy-sulfanylphosphanium?
The IUPAC name of (dicyclohexyl-λ4-sulfanylidene)-hydroxy-sulfanylphosphanium (CID 88651106) is (dicyclohexyl-λ4-sulfanylidene)-hydroxy-sulfanylphosphanium.
What is the SMILES notation for (dicyclohexyl-λ4-sulfanylidene)-hydroxy-sulfanylphosphanium?
The canonical SMILES for (dicyclohexyl-λ4-sulfanylidene)-hydroxy-sulfanylphosphanium is O[P+](S)=S(C1CCCCC1)C1CCCCC1.
What is the InChIKey of (dicyclohexyl-λ4-sulfanylidene)-hydroxy-sulfanylphosphanium?
The InChIKey is XIECQHXLDFQCEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24OPS2/c13-14(15)16(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h11-13,15H,1-10H2/q+1.
What are the key properties of (dicyclohexyl-λ4-sulfanylidene)-hydroxy-sulfanylphosphanium?
(dicyclohexyl-λ4-sulfanylidene)-hydroxy-sulfanylphosphanium has a molecular weight of 279.43 g/mol, XLogP of 4.42, 2 rotatable bonds, 2 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (dicyclohexyl-λ4-sulfanylidene)-hydroxy-sulfanylphosphanium is sourced from PubChem (CID 88651106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).