About dimethyl 2-(2,2-diisocyanatoethyl)octanedioate
dimethyl 2-(2,2-diisocyanatoethyl)octanedioate (PubChem CID 88651852) has the molecular formula C14H20N2O6
and a molecular weight of 312.32 g/mol. Its IUPAC name is dimethyl 2-(2,2-diisocyanatoethyl)octanedioate.
Molecular Properties
| Compound Name | dimethyl 2-(2,2-diisocyanatoethyl)octanedioate |
| PubChem CID | 88651852 |
| Molecular Formula | C14H20N2O6 |
| Molecular Weight | 312.32 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | dimethyl 2-(2,2-diisocyanatoethyl)octanedioate |
| SMILES | COC(=O)CCCCCC(CC(N=C=O)N=C=O)C(=O)OC |
| InChI | InChI=1S/C14H20N2O6/c1-21-13(19)7-5-3-4-6-11(14(20)22-2)8-12(15-9-17)16-10-18/h11-12H,3-8H2,1-2H3 |
| InChIKey | IXVHILBJACJHMQ-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 111.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.32 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze dimethyl 2-(2,2-diisocyanatoethyl)octanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 2-(2,2-diisocyanatoethyl)octanedioate?
The IUPAC name of dimethyl 2-(2,2-diisocyanatoethyl)octanedioate (CID 88651852) is dimethyl 2-(2,2-diisocyanatoethyl)octanedioate.
What is the SMILES notation for dimethyl 2-(2,2-diisocyanatoethyl)octanedioate?
The canonical SMILES for dimethyl 2-(2,2-diisocyanatoethyl)octanedioate is COC(=O)CCCCCC(CC(N=C=O)N=C=O)C(=O)OC.
What is the InChIKey of dimethyl 2-(2,2-diisocyanatoethyl)octanedioate?
The InChIKey is IXVHILBJACJHMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N2O6/c1-21-13(19)7-5-3-4-6-11(14(20)22-2)8-12(15-9-17)16-10-18/h11-12H,3-8H2,1-2H3.
What are the key properties of dimethyl 2-(2,2-diisocyanatoethyl)octanedioate?
dimethyl 2-(2,2-diisocyanatoethyl)octanedioate has a molecular weight of 312.32 g/mol, XLogP of 1.29, 11 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 2-(2,2-diisocyanatoethyl)octanedioate is sourced from PubChem (CID 88651852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).