C15H19NO4 — CID 88652048
N,N-bis(oxiran-2-ylmethyl)-5-propoxy-7-oxabicyclo[4.1.0]hepta-1,3,5-trien-2-amine (PubChem CID 88652048) has the molecular formula C15H19NO4 and a molecular weight of 277.32 g/mol. Its IUPAC name is N,N-bis(oxiran-2-ylmethyl)-5-propoxy-7-oxabicyclo[4.1.0]hepta-1,3,5-trien-2-amine.
| Compound Name | N,N-bis(oxiran-2-ylmethyl)-5-propoxy-7-oxabicyclo[4.1.0]hepta-1,3,5-trien-2-amine |
|---|---|
| PubChem CID | 88652048 |
| Molecular Formula | C15H19NO4 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | N,N-bis(oxiran-2-ylmethyl)-5-propoxy-7-oxabicyclo[4.1.0]hepta-1,3,5-trien-2-amine |
| SMILES | CCCOc1ccc(N(CC2CO2)CC2CO2)c2c1O2 |
| InChI | InChI=1S/C15H19NO4/c1-2-5-17-13-4-3-12(14-15(13)20-14)16(6-10-8-18-10)7-11-9-19-11/h3-4,10-11H,2,5-9H2,1H3 |
| InChIKey | WBNNGJHBCFLDLX-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 50.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|