C12H16N6O3+2 — CID 88652195
3,3,7-trimethyl-7-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]purine-3,7-diium-2,6-dione (PubChem CID 88652195) has the molecular formula C12H16N6O3+2 and a molecular weight of 292.30 g/mol. Its IUPAC name is 3,3,7-trimethyl-7-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]purine-3,7-diium-2,6-dione.
| Compound Name | 3,3,7-trimethyl-7-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]purine-3,7-diium-2,6-dione |
|---|---|
| PubChem CID | 88652195 |
| Molecular Formula | C12H16N6O3+2 |
| Molecular Weight | 292.30 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 3,3,7-trimethyl-7-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]purine-3,7-diium-2,6-dione |
| SMILES | Cc1nc(C[N+]2(C)C=NC3=C2C(=O)NC(=O)[N+]3(C)C)no1 |
| InChI | InChI=1S/C12H15N6O3/c1-7-14-8(16-21-7)5-18(4)6-13-10-9(18)11(19)15-12(20)17(10,2)3/h6H,5H2,1-4H3/q+1/p+1 |
| InChIKey | DBWQFISDOCQAGF-UHFFFAOYSA-O |
| XLogP | -0.14 |
| TPSA | 97.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.30 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|