About 1-(3,8-diazabicyclo[3.2.1]octan-1-yl)-2-fluoroethanone;hydrochloride
1-(3,8-diazabicyclo[3.2.1]octan-1-yl)-2-fluoroethanone;hydrochloride (PubChem CID 88652461) has the molecular formula C8H14ClFN2O
and a molecular weight of 208.66 g/mol. Its IUPAC name is 1-(3,8-diazabicyclo[3.2.1]octan-1-yl)-2-fluoroethanone;hydrochloride.
Molecular Properties
| Compound Name | 1-(3,8-diazabicyclo[3.2.1]octan-1-yl)-2-fluoroethanone;hydrochloride |
| PubChem CID | 88652461 |
| Molecular Formula | C8H14ClFN2O |
| Molecular Weight | 208.66 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | 1-(3,8-diazabicyclo[3.2.1]octan-1-yl)-2-fluoroethanone;hydrochloride |
| SMILES | Cl.O=C(CF)C12CCC(CNC1)N2 |
| InChI | InChI=1S/C8H13FN2O.ClH/c9-3-7(12)8-2-1-6(11-8)4-10-5-8;/h6,10-11H,1-5H2;1H |
| InChIKey | FHJZGOZTBYXCNE-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.66 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(3,8-diazabicyclo[3.2.1]octan-1-yl)-2-fluoroethanone;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,8-diazabicyclo[3.2.1]octan-1-yl)-2-fluoroethanone;hydrochloride?
The IUPAC name of 1-(3,8-diazabicyclo[3.2.1]octan-1-yl)-2-fluoroethanone;hydrochloride (CID 88652461) is 1-(3,8-diazabicyclo[3.2.1]octan-1-yl)-2-fluoroethanone;hydrochloride.
What is the SMILES notation for 1-(3,8-diazabicyclo[3.2.1]octan-1-yl)-2-fluoroethanone;hydrochloride?
The canonical SMILES for 1-(3,8-diazabicyclo[3.2.1]octan-1-yl)-2-fluoroethanone;hydrochloride is Cl.O=C(CF)C12CCC(CNC1)N2.
What is the InChIKey of 1-(3,8-diazabicyclo[3.2.1]octan-1-yl)-2-fluoroethanone;hydrochloride?
The InChIKey is FHJZGOZTBYXCNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13FN2O.ClH/c9-3-7(12)8-2-1-6(11-8)4-10-5-8;/h6,10-11H,1-5H2;1H.
What are the key properties of 1-(3,8-diazabicyclo[3.2.1]octan-1-yl)-2-fluoroethanone;hydrochloride?
1-(3,8-diazabicyclo[3.2.1]octan-1-yl)-2-fluoroethanone;hydrochloride has a molecular weight of 208.66 g/mol, XLogP of 0.04, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,8-diazabicyclo[3.2.1]octan-1-yl)-2-fluoroethanone;hydrochloride is sourced from PubChem (CID 88652461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).