C26H19N5O4S — CID 88652552
2-cyano-3-(1-cyclohexa-2,5-dien-1-yl-9H-thiochromeno[4,3-c]pyrazol-3-yl)-N-(3-nitrophenyl)-3-oxopropanamide (PubChem CID 88652552) has the molecular formula C26H19N5O4S and a molecular weight of 497.54 g/mol. Its IUPAC name is 2-cyano-3-(1-cyclohexa-2,5-dien-1-yl-9H-thiochromeno[4,3-c]pyrazol-3-yl)-N-(3-nitrophenyl)-3-oxopropanamide.
| Compound Name | 2-cyano-3-(1-cyclohexa-2,5-dien-1-yl-9H-thiochromeno[4,3-c]pyrazol-3-yl)-N-(3-nitrophenyl)-3-oxopropanamide |
|---|---|
| PubChem CID | 88652552 |
| Molecular Formula | C26H19N5O4S |
| Molecular Weight | 497.54 g/mol |
| Exact Mass | 497.12 |
| IUPAC Name | 2-cyano-3-(1-cyclohexa-2,5-dien-1-yl-9H-thiochromeno[4,3-c]pyrazol-3-yl)-N-(3-nitrophenyl)-3-oxopropanamide |
| SMILES | N#CC(C(=O)Nc1cccc([N+](=O)[O-])c1)C(=O)c1nn(C2C=CCC=C2)c2c1=CSC1=CC=CCC=21 |
| InChI | InChI=1S/C26H19N5O4S/c27-14-20(26(33)28-16-7-6-10-18(13-16)31(34)35)25(32)23-21-15-36-22-12-5-4-11-19(22)24(21)30(29-23)17-8-2-1-3-9-17/h2-10,12-13,15,17,20H,1,11H2,(H,28,33) |
| InChIKey | ASANJBQSPYLSQD-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 130.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.54 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|