C18H19ClN2O4 — CID 88652666
2-[2-chloro-5-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)-N-ethoxyanilino]acetaldehyde (PubChem CID 88652666) has the molecular formula C18H19ClN2O4 and a molecular weight of 362.81 g/mol. Its IUPAC name is 2-[2-chloro-5-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)-N-ethoxyanilino]acetaldehyde.
| Compound Name | 2-[2-chloro-5-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)-N-ethoxyanilino]acetaldehyde |
|---|---|
| PubChem CID | 88652666 |
| Molecular Formula | C18H19ClN2O4 |
| Molecular Weight | 362.81 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | 2-[2-chloro-5-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)-N-ethoxyanilino]acetaldehyde |
| SMILES | CCON(CC=O)c1cc(N2C(=O)C3=C(CCCC3)C2=O)ccc1Cl |
| InChI | InChI=1S/C18H19ClN2O4/c1-2-25-20(9-10-22)16-11-12(7-8-15(16)19)21-17(23)13-5-3-4-6-14(13)18(21)24/h7-8,10-11H,2-6,9H2,1H3 |
| InChIKey | OPTNBCJCUWPDLI-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.81 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|