C14H21NO5S — CID 88652718
ethanesulfonic acid;(E)-3-(4-hydroxyphenyl)-N-propan-2-ylprop-2-enamide (PubChem CID 88652718) has the molecular formula C14H21NO5S and a molecular weight of 315.39 g/mol. Its IUPAC name is ethanesulfonic acid;(E)-3-(4-hydroxyphenyl)-N-propan-2-ylprop-2-enamide.
| Compound Name | ethanesulfonic acid;(E)-3-(4-hydroxyphenyl)-N-propan-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 88652718 |
| Molecular Formula | C14H21NO5S |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | ethanesulfonic acid;(E)-3-(4-hydroxyphenyl)-N-propan-2-ylprop-2-enamide |
| SMILES | CC(C)NC(=O)/C=C/c1ccc(O)cc1.CCS(=O)(=O)O |
| InChI | InChI=1S/C12H15NO2.C2H6O3S/c1-9(2)13-12(15)8-5-10-3-6-11(14)7-4-10;1-2-6(3,4)5/h3-9,14H,1-2H3,(H,13,15);2H2,1H3,(H,3,4,5)/b8-5+; |
| InChIKey | WZTKQYRBQUJCBT-HAAWTFQLSA-N |
| XLogP | 1.82 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|