C11H6F12O — CID 88652943
1,2,3,4-tetrakis(trifluoromethyl)bicyclo[2.2.1]hept-2-en-7-ol (PubChem CID 88652943) has the molecular formula C11H6F12O and a molecular weight of 382.14 g/mol. Its IUPAC name is 1,2,3,4-tetrakis(trifluoromethyl)bicyclo[2.2.1]hept-2-en-7-ol.
| Compound Name | 1,2,3,4-tetrakis(trifluoromethyl)bicyclo[2.2.1]hept-2-en-7-ol |
|---|---|
| PubChem CID | 88652943 |
| Molecular Formula | C11H6F12O |
| Molecular Weight | 382.14 g/mol |
| Exact Mass | 382.02 |
| IUPAC Name | 1,2,3,4-tetrakis(trifluoromethyl)bicyclo[2.2.1]hept-2-en-7-ol |
| SMILES | OC1C2(C(F)(F)F)CCC1(C(F)(F)F)C(C(F)(F)F)=C2C(F)(F)F |
| InChI | InChI=1S/C11H6F12O/c12-8(13,14)3-4(9(15,16)17)7(11(21,22)23)2-1-6(3,5(7)24)10(18,19)20/h5,24H,1-2H2 |
| InChIKey | CIAUXDWTLIRHJY-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.14 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|