C6H6Cl6Re — CID 88652983
1,2,3,4,5,6-hexachlorocyclohexane;rhenium (PubChem CID 88652983) has the molecular formula C6H6Cl6Re and a molecular weight of 477.04 g/mol. Its IUPAC name is 1,2,3,4,5,6-hexachlorocyclohexane;rhenium.
| Compound Name | 1,2,3,4,5,6-hexachlorocyclohexane;rhenium |
|---|---|
| PubChem CID | 88652983 |
| Molecular Formula | C6H6Cl6Re |
| Molecular Weight | 477.04 g/mol |
| Exact Mass | 474.82 |
| IUPAC Name | 1,2,3,4,5,6-hexachlorocyclohexane;rhenium |
| SMILES | ClC1C(Cl)C(Cl)C(Cl)C(Cl)C1Cl.[Re] |
| InChI | InChI=1S/C6H6Cl6.Re/c7-1-2(8)4(10)6(12)5(11)3(1)9;/h1-6H; |
| InChIKey | UITWBAPJXNMBIU-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.04 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|