C33H68NO7P — CID 88653645
[(2S)-1-hydroxy-6,10,14,18-tetramethyl-4-oxo-3-pentoxynonadecan-2-yl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 88653645) has the molecular formula C33H68NO7P and a molecular weight of 621.88 g/mol. Its IUPAC name is [(2S)-1-hydroxy-6,10,14,18-tetramethyl-4-oxo-3-pentoxynonadecan-2-yl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [(2S)-1-hydroxy-6,10,14,18-tetramethyl-4-oxo-3-pentoxynonadecan-2-yl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 88653645 |
| Molecular Formula | C33H68NO7P |
| Molecular Weight | 621.88 g/mol |
| Exact Mass | 621.47 |
| IUPAC Name | [(2S)-1-hydroxy-6,10,14,18-tetramethyl-4-oxo-3-pentoxynonadecan-2-yl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CCCCCOC(C(=O)CC(C)CCCC(C)CCCC(C)CCCC(C)C)[C@H](CO)OP(=O)([O-])OCC[N+](C)(C)C |
| InChI | InChI=1S/C33H68NO7P/c1-10-11-12-23-39-33(32(26-35)41-42(37,38)40-24-22-34(7,8)9)31(36)25-30(6)21-15-20-29(5)19-14-18-28(4)17-13-16-27(2)3/h27-30,32-33,35H,10-26H2,1-9H3/t28?,29?,30?,32-,33?/m0/s1 |
| InChIKey | QPKMPSKIPYASOC-FBBDUFSQSA-N |
| XLogP | 7.16 |
| TPSA | 105.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.88 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|