C18H28O10 — CID 88653813
propanedioic acid;trimethyl (E)-4-methyloct-4-ene-1,1,8-tricarboxylate (PubChem CID 88653813) has the molecular formula C18H28O10 and a molecular weight of 404.41 g/mol. Its IUPAC name is propanedioic acid;trimethyl (E)-4-methyloct-4-ene-1,1,8-tricarboxylate.
| Compound Name | propanedioic acid;trimethyl (E)-4-methyloct-4-ene-1,1,8-tricarboxylate |
|---|---|
| PubChem CID | 88653813 |
| Molecular Formula | C18H28O10 |
| Molecular Weight | 404.41 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | propanedioic acid;trimethyl (E)-4-methyloct-4-ene-1,1,8-tricarboxylate |
| SMILES | COC(=O)CCC/C=C(\C)CCC(C(=O)OC)C(=O)OC.O=C(O)CC(=O)O |
| InChI | InChI=1S/C15H24O6.C3H4O4/c1-11(7-5-6-8-13(16)19-2)9-10-12(14(17)20-3)15(18)21-4;4-2(5)1-3(6)7/h7,12H,5-6,8-10H2,1-4H3;1H2,(H,4,5)(H,6,7)/b11-7+; |
| InChIKey | RDCKGKKLPVTSBA-RVDQCCQOSA-N |
| XLogP | 1.56 |
| TPSA | 153.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.41 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|