C11H23NO5 — CID 88654072
(1S)-1-[(2S,4R,5R)-4-hydroxy-5-(pentylamino)oxyoxolan-2-yl]ethane-1,2-diol (PubChem CID 88654072) has the molecular formula C11H23NO5 and a molecular weight of 249.31 g/mol. Its IUPAC name is (1S)-1-[(2S,4R,5R)-4-hydroxy-5-(pentylamino)oxyoxolan-2-yl]ethane-1,2-diol.
| Compound Name | (1S)-1-[(2S,4R,5R)-4-hydroxy-5-(pentylamino)oxyoxolan-2-yl]ethane-1,2-diol |
|---|---|
| PubChem CID | 88654072 |
| Molecular Formula | C11H23NO5 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.16 |
| IUPAC Name | (1S)-1-[(2S,4R,5R)-4-hydroxy-5-(pentylamino)oxyoxolan-2-yl]ethane-1,2-diol |
| SMILES | CCCCCNO[C@H]1O[C@H]([C@@H](O)CO)C[C@H]1O |
| InChI | InChI=1S/C11H23NO5/c1-2-3-4-5-12-17-11-8(14)6-10(16-11)9(15)7-13/h8-15H,2-7H2,1H3/t8-,9+,10+,11-/m1/s1 |
| InChIKey | JEJMDJOSMJVOCI-VPOLOUISSA-N |
| XLogP | -0.47 |
| TPSA | 91.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|