About hexane;2-methoxy-2-methylpropane;propan-2-one
hexane;2-methoxy-2-methylpropane;propan-2-one (PubChem CID 88654255) has the molecular formula C14H32O2
and a molecular weight of 232.41 g/mol. Its IUPAC name is hexane;2-methoxy-2-methylpropane;propan-2-one.
Molecular Properties
| Compound Name | hexane;2-methoxy-2-methylpropane;propan-2-one |
| PubChem CID | 88654255 |
| Molecular Formula | C14H32O2 |
| Molecular Weight | 232.41 g/mol |
| Exact Mass | 232.24 |
| IUPAC Name | hexane;2-methoxy-2-methylpropane;propan-2-one |
| SMILES | CC(C)=O.CCCCCC.COC(C)(C)C |
| InChI | InChI=1S/C6H14.C5H12O.C3H6O/c1-3-5-6-4-2;1-5(2,3)6-4;1-3(2)4/h3-6H2,1-2H3;1-4H3;1-2H3 |
| InChIKey | URGKYMPLWZZJBY-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.41 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze hexane;2-methoxy-2-methylpropane;propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexane;2-methoxy-2-methylpropane;propan-2-one?
The IUPAC name of hexane;2-methoxy-2-methylpropane;propan-2-one (CID 88654255) is hexane;2-methoxy-2-methylpropane;propan-2-one.
What is the SMILES notation for hexane;2-methoxy-2-methylpropane;propan-2-one?
The canonical SMILES for hexane;2-methoxy-2-methylpropane;propan-2-one is CC(C)=O.CCCCCC.COC(C)(C)C.
What is the InChIKey of hexane;2-methoxy-2-methylpropane;propan-2-one?
The InChIKey is URGKYMPLWZZJBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14.C5H12O.C3H6O/c1-3-5-6-4-2;1-5(2,3)6-4;1-3(2)4/h3-6H2,1-2H3;1-4H3;1-2H3.
What are the key properties of hexane;2-methoxy-2-methylpropane;propan-2-one?
hexane;2-methoxy-2-methylpropane;propan-2-one has a molecular weight of 232.41 g/mol, XLogP of 4.61, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hexane;2-methoxy-2-methylpropane;propan-2-one is sourced from PubChem (CID 88654255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).