C7F10O — CID 88654491
1,1,2,3,3,5,5,6,7,7-decafluorohepta-1,6-dien-4-one (PubChem CID 88654491) has the molecular formula C7F10O and a molecular weight of 290.06 g/mol. Its IUPAC name is 1,1,2,3,3,5,5,6,7,7-decafluorohepta-1,6-dien-4-one.
| Compound Name | 1,1,2,3,3,5,5,6,7,7-decafluorohepta-1,6-dien-4-one |
|---|---|
| PubChem CID | 88654491 |
| Molecular Formula | C7F10O |
| Molecular Weight | 290.06 g/mol |
| Exact Mass | 289.98 |
| IUPAC Name | 1,1,2,3,3,5,5,6,7,7-decafluorohepta-1,6-dien-4-one |
| SMILES | O=C(C(F)(F)C(F)=C(F)F)C(F)(F)C(F)=C(F)F |
| InChI | InChI=1S/C7F10O/c8-1(3(10)11)6(14,15)5(18)7(16,17)2(9)4(12)13 |
| InChIKey | HFITUWOKLHTGDV-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.06 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |