About propanoic acid;1-N-[1-(prop-2-enylamino)propan-2-yl]propane-1,2-diamine
propanoic acid;1-N-[1-(prop-2-enylamino)propan-2-yl]propane-1,2-diamine (PubChem CID 88654756) has the molecular formula C15H33N3O4
and a molecular weight of 319.45 g/mol. Its IUPAC name is propanoic acid;1-N-[1-(prop-2-enylamino)propan-2-yl]propane-1,2-diamine.
Molecular Properties
| Compound Name | propanoic acid;1-N-[1-(prop-2-enylamino)propan-2-yl]propane-1,2-diamine |
| PubChem CID | 88654756 |
| Molecular Formula | C15H33N3O4 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.25 |
| IUPAC Name | propanoic acid;1-N-[1-(prop-2-enylamino)propan-2-yl]propane-1,2-diamine |
| SMILES | C=CCNCC(C)NCC(C)N.CCC(=O)O.CCC(=O)O |
| InChI | InChI=1S/C9H21N3.2C3H6O2/c1-4-5-11-7-9(3)12-6-8(2)10;2*1-2-3(4)5/h4,8-9,11-12H,1,5-7,10H2,2-3H3;2*2H2,1H3,(H,4,5) |
| InChIKey | YHBXPUSIFCLXDA-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze propanoic acid;1-N-[1-(prop-2-enylamino)propan-2-yl]propane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propanoic acid;1-N-[1-(prop-2-enylamino)propan-2-yl]propane-1,2-diamine?
The IUPAC name of propanoic acid;1-N-[1-(prop-2-enylamino)propan-2-yl]propane-1,2-diamine (CID 88654756) is propanoic acid;1-N-[1-(prop-2-enylamino)propan-2-yl]propane-1,2-diamine.
What is the SMILES notation for propanoic acid;1-N-[1-(prop-2-enylamino)propan-2-yl]propane-1,2-diamine?
The canonical SMILES for propanoic acid;1-N-[1-(prop-2-enylamino)propan-2-yl]propane-1,2-diamine is C=CCNCC(C)NCC(C)N.CCC(=O)O.CCC(=O)O.
What is the InChIKey of propanoic acid;1-N-[1-(prop-2-enylamino)propan-2-yl]propane-1,2-diamine?
The InChIKey is YHBXPUSIFCLXDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H21N3.2C3H6O2/c1-4-5-11-7-9(3)12-6-8(2)10;2*1-2-3(4)5/h4,8-9,11-12H,1,5-7,10H2,2-3H3;2*2H2,1H3,(H,4,5).
What are the key properties of propanoic acid;1-N-[1-(prop-2-enylamino)propan-2-yl]propane-1,2-diamine?
propanoic acid;1-N-[1-(prop-2-enylamino)propan-2-yl]propane-1,2-diamine has a molecular weight of 319.45 g/mol, XLogP of 1.05, 9 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for propanoic acid;1-N-[1-(prop-2-enylamino)propan-2-yl]propane-1,2-diamine is sourced from PubChem (CID 88654756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).