C20H34O2 — CID 88655170
3,7,7-trimethyl-1-[(3,7,7-trimethyl-1-bicyclo[4.1.0]heptanyl)peroxy]bicyclo[4.1.0]heptane (PubChem CID 88655170) has the molecular formula C20H34O2 and a molecular weight of 306.49 g/mol. Its IUPAC name is 3,7,7-trimethyl-1-[(3,7,7-trimethyl-1-bicyclo[4.1.0]heptanyl)peroxy]bicyclo[4.1.0]heptane.
| Compound Name | 3,7,7-trimethyl-1-[(3,7,7-trimethyl-1-bicyclo[4.1.0]heptanyl)peroxy]bicyclo[4.1.0]heptane |
|---|---|
| PubChem CID | 88655170 |
| Molecular Formula | C20H34O2 |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.26 |
| IUPAC Name | 3,7,7-trimethyl-1-[(3,7,7-trimethyl-1-bicyclo[4.1.0]heptanyl)peroxy]bicyclo[4.1.0]heptane |
| SMILES | CC1CCC2C(C)(C)C2(OOC23CC(C)CCC2C3(C)C)C1 |
| InChI | InChI=1S/C20H34O2/c1-13-7-9-15-17(3,4)19(15,11-13)21-22-20-12-14(2)8-10-16(20)18(20,5)6/h13-16H,7-12H2,1-6H3 |
| InChIKey | ONBNMKRBRQWYLO-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|