C20H18F5N3O2S — CID 88655235
2-[(5-fluoro-2-pyrrolidin-1-ylphenyl)methylsulfinyl]-6-(1,1,2,2-tetrafluoroethoxy)-1H-benzimidazole (PubChem CID 88655235) has the molecular formula C20H18F5N3O2S and a molecular weight of 459.44 g/mol. Its IUPAC name is 2-[(5-fluoro-2-pyrrolidin-1-ylphenyl)methylsulfinyl]-6-(1,1,2,2-tetrafluoroethoxy)-1H-benzimidazole.
| Compound Name | 2-[(5-fluoro-2-pyrrolidin-1-ylphenyl)methylsulfinyl]-6-(1,1,2,2-tetrafluoroethoxy)-1H-benzimidazole |
|---|---|
| PubChem CID | 88655235 |
| Molecular Formula | C20H18F5N3O2S |
| Molecular Weight | 459.44 g/mol |
| Exact Mass | 459.10 |
| IUPAC Name | 2-[(5-fluoro-2-pyrrolidin-1-ylphenyl)methylsulfinyl]-6-(1,1,2,2-tetrafluoroethoxy)-1H-benzimidazole |
| SMILES | O=S(Cc1cc(F)ccc1N1CCCC1)c1nc2ccc(OC(F)(F)C(F)F)cc2[nH]1 |
| InChI | InChI=1S/C20H18F5N3O2S/c21-13-3-6-17(28-7-1-2-8-28)12(9-13)11-31(29)19-26-15-5-4-14(10-16(15)27-19)30-20(24,25)18(22)23/h3-6,9-10,18H,1-2,7-8,11H2,(H,26,27) |
| InChIKey | URUOANCTVFXJAG-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.44 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|