About 1-(4-amino-N-ethyl-3-methylanilino)ethane-1,1-disulfonic acid
1-(4-amino-N-ethyl-3-methylanilino)ethane-1,1-disulfonic acid (PubChem CID 88655563) has the molecular formula C11H18N2O6S2
and a molecular weight of 338.41 g/mol. Its IUPAC name is 1-(4-amino-N-ethyl-3-methylanilino)ethane-1,1-disulfonic acid.
Molecular Properties
| Compound Name | 1-(4-amino-N-ethyl-3-methylanilino)ethane-1,1-disulfonic acid |
| PubChem CID | 88655563 |
| Molecular Formula | C11H18N2O6S2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | 1-(4-amino-N-ethyl-3-methylanilino)ethane-1,1-disulfonic acid |
| SMILES | CCN(c1ccc(N)c(C)c1)C(C)(S(=O)(=O)O)S(=O)(=O)O |
| InChI | InChI=1S/C11H18N2O6S2/c1-4-13(9-5-6-10(12)8(2)7-9)11(3,20(14,15)16)21(17,18)19/h5-7H,4,12H2,1-3H3,(H,14,15,16)(H,17,18,19) |
| InChIKey | HILROVLYQJBBKJ-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 138.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-amino-N-ethyl-3-methylanilino)ethane-1,1-disulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-amino-N-ethyl-3-methylanilino)ethane-1,1-disulfonic acid?
The IUPAC name of 1-(4-amino-N-ethyl-3-methylanilino)ethane-1,1-disulfonic acid (CID 88655563) is 1-(4-amino-N-ethyl-3-methylanilino)ethane-1,1-disulfonic acid.
What is the SMILES notation for 1-(4-amino-N-ethyl-3-methylanilino)ethane-1,1-disulfonic acid?
The canonical SMILES for 1-(4-amino-N-ethyl-3-methylanilino)ethane-1,1-disulfonic acid is CCN(c1ccc(N)c(C)c1)C(C)(S(=O)(=O)O)S(=O)(=O)O.
What is the InChIKey of 1-(4-amino-N-ethyl-3-methylanilino)ethane-1,1-disulfonic acid?
The InChIKey is HILROVLYQJBBKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O6S2/c1-4-13(9-5-6-10(12)8(2)7-9)11(3,20(14,15)16)21(17,18)19/h5-7H,4,12H2,1-3H3,(H,14,15,16)(H,17,18,19).
What are the key properties of 1-(4-amino-N-ethyl-3-methylanilino)ethane-1,1-disulfonic acid?
1-(4-amino-N-ethyl-3-methylanilino)ethane-1,1-disulfonic acid has a molecular weight of 338.41 g/mol, XLogP of 0.85, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-amino-N-ethyl-3-methylanilino)ethane-1,1-disulfonic acid is sourced from PubChem (CID 88655563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).