C84H111O4P — CID 88655611
tris[[4-[(E)-2-[5,5,8,8-tetramethyl-3-(2-methylpropyl)-6,7-dihydronaphthalen-2-yl]prop-1-enyl]phenyl]methyl] phosphate (PubChem CID 88655611) has the molecular formula C84H111O4P and a molecular weight of 1215.78 g/mol. Its IUPAC name is tris[[4-[(E)-2-[5,5,8,8-tetramethyl-3-(2-methylpropyl)-6,7-dihydronaphthalen-2-yl]prop-1-enyl]phenyl]methyl] phosphate.
| Compound Name | tris[[4-[(E)-2-[5,5,8,8-tetramethyl-3-(2-methylpropyl)-6,7-dihydronaphthalen-2-yl]prop-1-enyl]phenyl]methyl] phosphate |
|---|---|
| PubChem CID | 88655611 |
| Molecular Formula | C84H111O4P |
| Molecular Weight | 1215.78 g/mol |
| Exact Mass | 1214.82 |
| IUPAC Name | tris[[4-[(E)-2-[5,5,8,8-tetramethyl-3-(2-methylpropyl)-6,7-dihydronaphthalen-2-yl]prop-1-enyl]phenyl]methyl] phosphate |
| SMILES | C/C(=C\c1ccc(COP(=O)(OCc2ccc(/C=C(\C)c3cc4c(cc3CC(C)C)C(C)(C)CCC4(C)C)cc2)OCc2ccc(/C=C(\C)c3cc4c(cc3CC(C)C)C(C)(C)CCC4(C)C)cc2)cc1)c1cc2c(cc1CC(C)C)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C84H111O4P/c1-55(2)40-67-46-73-76(82(16,17)37-34-79(73,10)11)49-70(67)58(7)43-61-22-28-64(29-23-61)52-86-89(85,87-53-65-30-24-62(25-31-65)44-59(8)71-50-77-74(47-68(71)41-56(3)4)80(12,13)35-38-83(77,18)19)88-54-66-32-26-63(27-33-66)45-60(9)72-51-78-75(48-69(72)42-57(5)6)81(14,15)36-39-84(78,20)21/h22-33,43-51,55-57H,34-42,52-54H2,1-21H3/b58-43+,59-44+,60-45+ |
| InChIKey | WVEGHXQHRHSXHS-VDWMVRMZSA-N |
| XLogP | 24.07 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 89 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1215.78 |
| LogP ≤ 5 | 24.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|