C23H24F4N2O3 — CID 88655694
2,4,5-trifluoro-N-[2-[4-(4-fluorobenzoyl)piperidin-1-yl]ethyl]-6-methoxy-3-methylbenzamide (PubChem CID 88655694) has the molecular formula C23H24F4N2O3 and a molecular weight of 452.45 g/mol. Its IUPAC name is 2,4,5-trifluoro-N-[2-[4-(4-fluorobenzoyl)piperidin-1-yl]ethyl]-6-methoxy-3-methylbenzamide.
| Compound Name | 2,4,5-trifluoro-N-[2-[4-(4-fluorobenzoyl)piperidin-1-yl]ethyl]-6-methoxy-3-methylbenzamide |
|---|---|
| PubChem CID | 88655694 |
| Molecular Formula | C23H24F4N2O3 |
| Molecular Weight | 452.45 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | 2,4,5-trifluoro-N-[2-[4-(4-fluorobenzoyl)piperidin-1-yl]ethyl]-6-methoxy-3-methylbenzamide |
| SMILES | COc1c(F)c(F)c(C)c(F)c1C(=O)NCCN1CCC(C(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C23H24F4N2O3/c1-13-18(25)17(22(32-2)20(27)19(13)26)23(31)28-9-12-29-10-7-15(8-11-29)21(30)14-3-5-16(24)6-4-14/h3-6,15H,7-12H2,1-2H3,(H,28,31) |
| InChIKey | YDVQJENBHJXAKZ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.45 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|