C10H11ClFNO2S — CID 88655773
S-methyl 3-(5-amino-2-chloro-4-fluorophenyl)-2-hydroxypropanethioate (PubChem CID 88655773) has the molecular formula C10H11ClFNO2S and a molecular weight of 263.72 g/mol. Its IUPAC name is S-methyl 3-(5-amino-2-chloro-4-fluorophenyl)-2-hydroxypropanethioate.
| Compound Name | S-methyl 3-(5-amino-2-chloro-4-fluorophenyl)-2-hydroxypropanethioate |
|---|---|
| PubChem CID | 88655773 |
| Molecular Formula | C10H11ClFNO2S |
| Molecular Weight | 263.72 g/mol |
| Exact Mass | 263.02 |
| IUPAC Name | S-methyl 3-(5-amino-2-chloro-4-fluorophenyl)-2-hydroxypropanethioate |
| SMILES | CSC(=O)C(O)Cc1cc(N)c(F)cc1Cl |
| InChI | InChI=1S/C10H11ClFNO2S/c1-16-10(15)9(14)3-5-2-8(13)7(12)4-6(5)11/h2,4,9,14H,3,13H2,1H3 |
| InChIKey | OJQSXXPRMQFALT-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.72 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|