C18H19ClF3N3S2 — CID 88655857
3-[3,5-dimethyl-1-[6-(trifluoromethyl)-1H-benzimidazol-2-yl]pyridin-1-ium-2-yl]propane-1,2-dithiol chloride (PubChem CID 88655857) has the molecular formula C18H19ClF3N3S2 and a molecular weight of 433.95 g/mol. Its IUPAC name is 3-[3,5-dimethyl-1-[6-(trifluoromethyl)-1H-benzimidazol-2-yl]pyridin-1-ium-2-yl]propane-1,2-dithiol chloride.
| Compound Name | 3-[3,5-dimethyl-1-[6-(trifluoromethyl)-1H-benzimidazol-2-yl]pyridin-1-ium-2-yl]propane-1,2-dithiol chloride |
|---|---|
| PubChem CID | 88655857 |
| Molecular Formula | C18H19ClF3N3S2 |
| Molecular Weight | 433.95 g/mol |
| Exact Mass | 433.07 |
| IUPAC Name | 3-[3,5-dimethyl-1-[6-(trifluoromethyl)-1H-benzimidazol-2-yl]pyridin-1-ium-2-yl]propane-1,2-dithiol chloride |
| SMILES | Cc1cc(C)c(CC(S)CS)[n+](-c2nc3ccc(C(F)(F)F)cc3[nH]2)c1.[Cl-] |
| InChI | InChI=1S/C18H18F3N3S2.ClH/c1-10-5-11(2)16(7-13(26)9-25)24(8-10)17-22-14-4-3-12(18(19,20)21)6-15(14)23-17;/h3-6,8,13H,7,9H2,1-2H3,(H2-,22,23,25,26);1H |
| InChIKey | MUKBGOAXOQZWIE-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 32.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.95 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|