C19F34 — CID 88655862
1,2,3,5,5,6,6,7,7-nonafluoro-4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-pentacosafluorododecyl)bicyclo[2.2.1]hept-2-ene (PubChem CID 88655862) has the molecular formula C19F34 and a molecular weight of 874.14 g/mol. Its IUPAC name is 1,2,3,5,5,6,6,7,7-nonafluoro-4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-pentacosafluorododecyl)bicyclo[2.2.1]hept-2-ene.
| Compound Name | 1,2,3,5,5,6,6,7,7-nonafluoro-4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-pentacosafluorododecyl)bicyclo[2.2.1]hept-2-ene |
|---|---|
| PubChem CID | 88655862 |
| Molecular Formula | C19F34 |
| Molecular Weight | 874.14 g/mol |
| Exact Mass | 873.95 |
| IUPAC Name | 1,2,3,5,5,6,6,7,7-nonafluoro-4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-pentacosafluorododecyl)bicyclo[2.2.1]hept-2-ene |
| SMILES | FC1=C(F)C2(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C1(F)C2(F)F |
| InChI | InChI=1S/C19F34/c20-1-2(21)4(22)5(23,24)3(1,6(25,26)8(4,29)30)7(27,28)9(31,32)10(33,34)11(35,36)12(37,38)13(39,40)14(41,42)15(43,44)16(45,46)17(47,48)18(49,50)19(51,52)53 |
| InChIKey | PGAXIWNVZHFBQR-UHFFFAOYSA-N |
| XLogP | 11.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 874.14 |
| LogP ≤ 5 | 11.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|