About 2,6-dichloro-4-(1-chloroethyl)heptane;dihydroxy(oxo)phosphanium
2,6-dichloro-4-(1-chloroethyl)heptane;dihydroxy(oxo)phosphanium (PubChem CID 88657195) has the molecular formula C9H19Cl3O3P+
and a molecular weight of 312.58 g/mol. Its IUPAC name is 2,6-dichloro-4-(1-chloroethyl)heptane;dihydroxy(oxo)phosphanium.
Molecular Properties
| Compound Name | 2,6-dichloro-4-(1-chloroethyl)heptane;dihydroxy(oxo)phosphanium |
| PubChem CID | 88657195 |
| Molecular Formula | C9H19Cl3O3P+ |
| Molecular Weight | 312.58 g/mol |
| Exact Mass | 311.01 |
| IUPAC Name | 2,6-dichloro-4-(1-chloroethyl)heptane;dihydroxy(oxo)phosphanium |
| SMILES | CC(Cl)CC(CC(C)Cl)C(C)Cl.O=[P+](O)O |
| InChI | InChI=1S/C9H17Cl3.HO3P/c1-6(10)4-9(8(3)12)5-7(2)11;1-4(2)3/h6-9H,4-5H2,1-3H3;(H-,1,2,3)/p+1 |
| InChIKey | FDJOTZMKJKGQAT-UHFFFAOYSA-O |
| XLogP | 3.89 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.58 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2,6-dichloro-4-(1-chloroethyl)heptane;dihydroxy(oxo)phosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dichloro-4-(1-chloroethyl)heptane;dihydroxy(oxo)phosphanium?
The IUPAC name of 2,6-dichloro-4-(1-chloroethyl)heptane;dihydroxy(oxo)phosphanium (CID 88657195) is 2,6-dichloro-4-(1-chloroethyl)heptane;dihydroxy(oxo)phosphanium.
What is the SMILES notation for 2,6-dichloro-4-(1-chloroethyl)heptane;dihydroxy(oxo)phosphanium?
The canonical SMILES for 2,6-dichloro-4-(1-chloroethyl)heptane;dihydroxy(oxo)phosphanium is CC(Cl)CC(CC(C)Cl)C(C)Cl.O=[P+](O)O.
What is the InChIKey of 2,6-dichloro-4-(1-chloroethyl)heptane;dihydroxy(oxo)phosphanium?
The InChIKey is FDJOTZMKJKGQAT-UHFFFAOYSA-O. The full InChI is InChI=1S/C9H17Cl3.HO3P/c1-6(10)4-9(8(3)12)5-7(2)11;1-4(2)3/h6-9H,4-5H2,1-3H3;(H-,1,2,3)/p+1.
What are the key properties of 2,6-dichloro-4-(1-chloroethyl)heptane;dihydroxy(oxo)phosphanium?
2,6-dichloro-4-(1-chloroethyl)heptane;dihydroxy(oxo)phosphanium has a molecular weight of 312.58 g/mol, XLogP of 3.89, 5 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dichloro-4-(1-chloroethyl)heptane;dihydroxy(oxo)phosphanium is sourced from PubChem (CID 88657195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).