C10H9F10NO — CID 88657249
2-(1,2,2,3,3,4,4,5,5,6-decafluorocyclohexyl)-N-methylpropanamide (PubChem CID 88657249) has the molecular formula C10H9F10NO and a molecular weight of 349.17 g/mol. Its IUPAC name is 2-(1,2,2,3,3,4,4,5,5,6-decafluorocyclohexyl)-N-methylpropanamide.
| Compound Name | 2-(1,2,2,3,3,4,4,5,5,6-decafluorocyclohexyl)-N-methylpropanamide |
|---|---|
| PubChem CID | 88657249 |
| Molecular Formula | C10H9F10NO |
| Molecular Weight | 349.17 g/mol |
| Exact Mass | 349.05 |
| IUPAC Name | 2-(1,2,2,3,3,4,4,5,5,6-decafluorocyclohexyl)-N-methylpropanamide |
| SMILES | CNC(=O)C(C)C1(F)C(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C10H9F10NO/c1-3(4(22)21-2)6(12)5(11)7(13,14)9(17,18)10(19,20)8(6,15)16/h3,5H,1-2H3,(H,21,22) |
| InChIKey | JOKIIPVBWKTFDF-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.17 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|