About (NE)-N-(3-methoxy-10-methyl-7,8-dihydro-6H-pyrido[1,2-a]indol-9-ylidene)hydroxylamine
(NE)-N-(3-methoxy-10-methyl-7,8-dihydro-6H-pyrido[1,2-a]indol-9-ylidene)hydroxylamine (PubChem CID 88658139) has the molecular formula C14H16N2O2
and a molecular weight of 244.29 g/mol. Its IUPAC name is (NE)-N-(3-methoxy-10-methyl-7,8-dihydro-6H-pyrido[1,2-a]indol-9-ylidene)hydroxylamine.
Molecular Properties
| Compound Name | (NE)-N-(3-methoxy-10-methyl-7,8-dihydro-6H-pyrido[1,2-a]indol-9-ylidene)hydroxylamine |
| PubChem CID | 88658139 |
| Molecular Formula | C14H16N2O2 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | (NE)-N-(3-methoxy-10-methyl-7,8-dihydro-6H-pyrido[1,2-a]indol-9-ylidene)hydroxylamine |
| SMILES | COc1ccc2c(C)c3n(c2c1)CCC/C3=N\O |
| InChI | InChI=1S/C14H16N2O2/c1-9-11-6-5-10(18-2)8-13(11)16-7-3-4-12(15-17)14(9)16/h5-6,8,17H,3-4,7H2,1-2H3/b15-12+ |
| InChIKey | YKRUTSZTSDHPPC-NTCAYCPXSA-N |
| XLogP | 2.93 |
| TPSA | 46.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (NE)-N-(3-methoxy-10-methyl-7,8-dihydro-6H-pyrido[1,2-a]indol-9-ylidene)hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (NE)-N-(3-methoxy-10-methyl-7,8-dihydro-6H-pyrido[1,2-a]indol-9-ylidene)hydroxylamine?
The IUPAC name of (NE)-N-(3-methoxy-10-methyl-7,8-dihydro-6H-pyrido[1,2-a]indol-9-ylidene)hydroxylamine (CID 88658139) is (NE)-N-(3-methoxy-10-methyl-7,8-dihydro-6H-pyrido[1,2-a]indol-9-ylidene)hydroxylamine.
What is the SMILES notation for (NE)-N-(3-methoxy-10-methyl-7,8-dihydro-6H-pyrido[1,2-a]indol-9-ylidene)hydroxylamine?
The canonical SMILES for (NE)-N-(3-methoxy-10-methyl-7,8-dihydro-6H-pyrido[1,2-a]indol-9-ylidene)hydroxylamine is COc1ccc2c(C)c3n(c2c1)CCC/C3=N\O.
What is the InChIKey of (NE)-N-(3-methoxy-10-methyl-7,8-dihydro-6H-pyrido[1,2-a]indol-9-ylidene)hydroxylamine?
The InChIKey is YKRUTSZTSDHPPC-NTCAYCPXSA-N. The full InChI is InChI=1S/C14H16N2O2/c1-9-11-6-5-10(18-2)8-13(11)16-7-3-4-12(15-17)14(9)16/h5-6,8,17H,3-4,7H2,1-2H3/b15-12+.
What are the key properties of (NE)-N-(3-methoxy-10-methyl-7,8-dihydro-6H-pyrido[1,2-a]indol-9-ylidene)hydroxylamine?
(NE)-N-(3-methoxy-10-methyl-7,8-dihydro-6H-pyrido[1,2-a]indol-9-ylidene)hydroxylamine has a molecular weight of 244.29 g/mol, XLogP of 2.93, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (NE)-N-(3-methoxy-10-methyl-7,8-dihydro-6H-pyrido[1,2-a]indol-9-ylidene)hydroxylamine is sourced from PubChem (CID 88658139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).