C6H10F2O4S — CID 88658240
(2R,3S,4S)-5-(difluoromethylsulfanyl)-2,3,4-trihydroxypentanal (PubChem CID 88658240) has the molecular formula C6H10F2O4S and a molecular weight of 216.20 g/mol. Its IUPAC name is (2R,3S,4S)-5-(difluoromethylsulfanyl)-2,3,4-trihydroxypentanal.
| Compound Name | (2R,3S,4S)-5-(difluoromethylsulfanyl)-2,3,4-trihydroxypentanal |
|---|---|
| PubChem CID | 88658240 |
| Molecular Formula | C6H10F2O4S |
| Molecular Weight | 216.20 g/mol |
| Exact Mass | 216.03 |
| IUPAC Name | (2R,3S,4S)-5-(difluoromethylsulfanyl)-2,3,4-trihydroxypentanal |
| SMILES | O=C[C@H](O)[C@H](O)[C@H](O)CSC(F)F |
| InChI | InChI=1S/C6H10F2O4S/c7-6(8)13-2-4(11)5(12)3(10)1-9/h1,3-6,10-12H,2H2/t3-,4+,5-/m0/s1 |
| InChIKey | ZCJNDMOCEDWFSL-LMVFSUKVSA-N |
| XLogP | -0.78 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.20 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|