C15H22BrNO4S2 — CID 88658966
2,2-dimethylpropanoyloxymethyl (2S,5R,6R)-6-bromo-3,3,6-trimethyl-7-sulfanylidene-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 88658966) has the molecular formula C15H22BrNO4S2 and a molecular weight of 424.38 g/mol. Its IUPAC name is 2,2-dimethylpropanoyloxymethyl (2S,5R,6R)-6-bromo-3,3,6-trimethyl-7-sulfanylidene-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | 2,2-dimethylpropanoyloxymethyl (2S,5R,6R)-6-bromo-3,3,6-trimethyl-7-sulfanylidene-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 88658966 |
| Molecular Formula | C15H22BrNO4S2 |
| Molecular Weight | 424.38 g/mol |
| Exact Mass | 423.02 |
| IUPAC Name | 2,2-dimethylpropanoyloxymethyl (2S,5R,6R)-6-bromo-3,3,6-trimethyl-7-sulfanylidene-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | CC(C)(C)C(=O)OCOC(=O)[C@@H]1N2C(=S)[C@](C)(Br)[C@H]2SC1(C)C |
| InChI | InChI=1S/C15H22BrNO4S2/c1-13(2,3)12(19)21-7-20-9(18)8-14(4,5)23-11-15(6,16)10(22)17(8)11/h8,11H,7H2,1-6H3/t8-,11+,15-/m0/s1 |
| InChIKey | DTOUHMHQUJAWKJ-AVZKPZGTSA-N |
| XLogP | 3.09 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.38 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|