About 4-chloro-3-nitroquinoline;3-nitro-N-octylquinolin-4-amine;octan-1-amine
4-chloro-3-nitroquinoline;3-nitro-N-octylquinolin-4-amine;octan-1-amine (PubChem CID 88659028) has the molecular formula C34H47ClN6O4
and a molecular weight of 639.24 g/mol. Its IUPAC name is 4-chloro-3-nitroquinoline;3-nitro-N-octylquinolin-4-amine;octan-1-amine.
Molecular Properties
| Compound Name | 4-chloro-3-nitroquinoline;3-nitro-N-octylquinolin-4-amine;octan-1-amine |
| PubChem CID | 88659028 |
| Molecular Formula | C34H47ClN6O4 |
| Molecular Weight | 639.24 g/mol |
| Exact Mass | 638.33 |
| IUPAC Name | 4-chloro-3-nitroquinoline;3-nitro-N-octylquinolin-4-amine;octan-1-amine |
| SMILES | CCCCCCCCN.CCCCCCCCNc1c([N+](=O)[O-])cnc2ccccc12.O=[N+]([O-])c1cnc2ccccc2c1Cl |
| InChI | InChI=1S/C17H23N3O2.C9H5ClN2O2.C8H19N/c1-2-3-4-5-6-9-12-18-17-14-10-7-8-11-15(14)19-13-16(17)20(21)22;10-9-6-3-1-2-4-7(6)11-5-8(9)12(13)14;1-2-3-4-5-6-7-8-9/h7-8,10-11,13H,2-6,9,12H2,1H3,(H,18,19);1-5H;2-9H2,1H3 |
| InChIKey | TXQUKHGWJREZNW-UHFFFAOYSA-N |
| XLogP | 10.02 |
| TPSA | 150.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 639.24 |
| LogP ≤ 5 | 10.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-3-nitroquinoline;3-nitro-N-octylquinolin-4-amine;octan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-3-nitroquinoline;3-nitro-N-octylquinolin-4-amine;octan-1-amine?
The IUPAC name of 4-chloro-3-nitroquinoline;3-nitro-N-octylquinolin-4-amine;octan-1-amine (CID 88659028) is 4-chloro-3-nitroquinoline;3-nitro-N-octylquinolin-4-amine;octan-1-amine.
What is the SMILES notation for 4-chloro-3-nitroquinoline;3-nitro-N-octylquinolin-4-amine;octan-1-amine?
The canonical SMILES for 4-chloro-3-nitroquinoline;3-nitro-N-octylquinolin-4-amine;octan-1-amine is CCCCCCCCN.CCCCCCCCNc1c([N+](=O)[O-])cnc2ccccc12.O=[N+]([O-])c1cnc2ccccc2c1Cl.
What is the InChIKey of 4-chloro-3-nitroquinoline;3-nitro-N-octylquinolin-4-amine;octan-1-amine?
The InChIKey is TXQUKHGWJREZNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23N3O2.C9H5ClN2O2.C8H19N/c1-2-3-4-5-6-9-12-18-17-14-10-7-8-11-15(14)19-13-16(17)20(21)22;10-9-6-3-1-2-4-7(6)11-5-8(9)12(13)14;1-2-3-4-5-6-7-8-9/h7-8,10-11,13H,2-6,9,12H2,1H3,(H,18,19);1-5H;2-9H2,1H3.
What are the key properties of 4-chloro-3-nitroquinoline;3-nitro-N-octylquinolin-4-amine;octan-1-amine?
4-chloro-3-nitroquinoline;3-nitro-N-octylquinolin-4-amine;octan-1-amine has a molecular weight of 639.24 g/mol, XLogP of 10.02, 16 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-3-nitroquinoline;3-nitro-N-octylquinolin-4-amine;octan-1-amine is sourced from PubChem (CID 88659028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).