C13H17ClN4O2 — CID 88660126
4-chloro-4-N,5,6,6-tetramethyl-3-nitroquinoline-2,4-diamine (PubChem CID 88660126) has the molecular formula C13H17ClN4O2 and a molecular weight of 296.76 g/mol. Its IUPAC name is 4-chloro-4-N,5,6,6-tetramethyl-3-nitroquinoline-2,4-diamine.
| Compound Name | 4-chloro-4-N,5,6,6-tetramethyl-3-nitroquinoline-2,4-diamine |
|---|---|
| PubChem CID | 88660126 |
| Molecular Formula | C13H17ClN4O2 |
| Molecular Weight | 296.76 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | 4-chloro-4-N,5,6,6-tetramethyl-3-nitroquinoline-2,4-diamine |
| SMILES | CNC1(Cl)C2=C(C)C(C)(C)C=CC2=NC(N)=C1[N+](=O)[O-] |
| InChI | InChI=1S/C13H17ClN4O2/c1-7-9-8(5-6-12(7,2)3)17-11(15)10(18(19)20)13(9,14)16-4/h5-6,16H,15H2,1-4H3 |
| InChIKey | QYZSZOXQWQCEKT-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 93.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.76 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|